C11H7F3O3S — CID 138479110
6-sulfanyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 138479110) has the molecular formula C11H7F3O3S and a molecular weight of 276.24 g/mol. Its IUPAC name is 6-sulfanyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-sulfanyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 138479110 |
| Molecular Formula | C11H7F3O3S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 6-sulfanyl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(S)ccc2OC1C(F)(F)F |
| InChI | InChI=1S/C11H7F3O3S/c12-11(13,14)9-7(10(15)16)4-5-3-6(18)1-2-8(5)17-9/h1-4,9,18H,(H,15,16) |
| InChIKey | ZAEWCXFCIRUQSP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|