C15H14F3NO3 — CID 58934939
7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934939) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934939 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 7-pyrrolidin-1-yl-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccc(N3CCCC3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO3/c16-15(17,18)13-11(14(20)21)7-9-3-4-10(8-12(9)22-13)19-5-1-2-6-19/h3-4,7-8,13H,1-2,5-6H2,(H,20,21) |
| InChIKey | HLMLGVFDVMPMLC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|