C20H17F3O3 — CID 58934607
6-methyl-7-[(2-methylphenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934607) has the molecular formula C20H17F3O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 6-methyl-7-[(2-methylphenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-methyl-7-[(2-methylphenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934607 |
| Molecular Formula | C20H17F3O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 6-methyl-7-[(2-methylphenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | Cc1ccccc1Cc1cc2c(cc1C)C=C(C(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C20H17F3O3/c1-11-5-3-4-6-13(11)8-14-10-17-15(7-12(14)2)9-16(19(24)25)18(26-17)20(21,22)23/h3-7,9-10,18H,8H2,1-2H3,(H,24,25) |
| InChIKey | DLJBYXBVYDUITK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |