C19H15F3O3 — CID 58934997
7-(1-phenylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934997) has the molecular formula C19H15F3O3 and a molecular weight of 348.32 g/mol. Its IUPAC name is 7-(1-phenylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-(1-phenylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934997 |
| Molecular Formula | C19H15F3O3 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 7-(1-phenylethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CC(c1ccccc1)c1ccc2c(c1)OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C19H15F3O3/c1-11(12-5-3-2-4-6-12)13-7-8-14-9-15(18(23)24)17(19(20,21)22)25-16(14)10-13/h2-11,17H,1H3,(H,23,24) |
| InChIKey | IJSBTMFGKZYHJZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |