C18H19F3O3 — CID 58934706
7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 58934706) has the molecular formula C18H19F3O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 58934706 |
| Molecular Formula | C18H19F3O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 7-(cyclohexylmethyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2ccc(CC3CCCCC3)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C18H19F3O3/c19-18(20,21)16-14(17(22)23)10-13-7-6-12(9-15(13)24-16)8-11-4-2-1-3-5-11/h6-7,9-11,16H,1-5,8H2,(H,22,23) |
| InChIKey | ZPPJAHAGACBBAI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |