C20H15F6NO4 — CID 162257944
7-[(4-aminophenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;2,2,2-trifluoroacetaldehyde (PubChem CID 162257944) has the molecular formula C20H15F6NO4 and a molecular weight of 447.33 g/mol. Its IUPAC name is 7-[(4-aminophenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;2,2,2-trifluoroacetaldehyde.
| Compound Name | 7-[(4-aminophenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 162257944 |
| Molecular Formula | C20H15F6NO4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 7-[(4-aminophenyl)methyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid;2,2,2-trifluoroacetaldehyde |
| SMILES | Nc1ccc(Cc2ccc3c(c2)OC(C(F)(F)F)C(C(=O)O)=C3)cc1.O=CC(F)(F)F |
| InChI | InChI=1S/C18H14F3NO3.C2HF3O/c19-18(20,21)16-14(17(23)24)9-12-4-1-11(8-15(12)25-16)7-10-2-5-13(22)6-3-10;3-2(4,5)1-6/h1-6,8-9,16H,7,22H2,(H,23,24);1H |
| InChIKey | ZYVQSSDMPGPTRU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|