About 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid
7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid (PubChem CID 142848547) has the molecular formula C17H19F3O3
and a molecular weight of 328.33 g/mol. Its IUPAC name is 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid |
| PubChem CID | 142848547 |
| Molecular Formula | C17H19F3O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid |
| SMILES | CC(F)C(F)(F)C1Oc2cc(C(C)(C)C)ccc2C=C1C(=O)O |
| InChI | InChI=1S/C17H19F3O3/c1-9(18)17(19,20)14-12(15(21)22)7-10-5-6-11(16(2,3)4)8-13(10)23-14/h5-9,14H,1-4H3,(H,21,22) |
| InChIKey | JIALAIHISQABGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid?
The IUPAC name of 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid (CID 142848547) is 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid.
What is the SMILES notation for 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid?
The canonical SMILES for 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid is CC(F)C(F)(F)C1Oc2cc(C(C)(C)C)ccc2C=C1C(=O)O.
What is the InChIKey of 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid?
The InChIKey is JIALAIHISQABGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3O3/c1-9(18)17(19,20)14-12(15(21)22)7-10-5-6-11(16(2,3)4)8-13(10)23-14/h5-9,14H,1-4H3,(H,21,22).
What are the key properties of 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid?
7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid has a molecular weight of 328.33 g/mol, XLogP of 4.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-2-(1,1,2-trifluoropropyl)-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 142848547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).