C16H19F2O3P — CID 142174450
7-tert-butyl-2-(1,2-difluoro-1-phosphanylethyl)-2H-chromene-3-carboxylic acid (PubChem CID 142174450) has the molecular formula C16H19F2O3P and a molecular weight of 328.30 g/mol. Its IUPAC name is 7-tert-butyl-2-(1,2-difluoro-1-phosphanylethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 7-tert-butyl-2-(1,2-difluoro-1-phosphanylethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 142174450 |
| Molecular Formula | C16H19F2O3P |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 7-tert-butyl-2-(1,2-difluoro-1-phosphanylethyl)-2H-chromene-3-carboxylic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)OC(C(F)(P)CF)C(C(=O)O)=C2 |
| InChI | InChI=1S/C16H19F2O3P/c1-15(2,3)10-5-4-9-6-11(14(19)20)13(16(18,22)8-17)21-12(9)7-10/h4-7,13H,8,22H2,1-3H3,(H,19,20) |
| InChIKey | SXACKOMHHBRPNJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|