C18H22N2O2 — CID 59774480
3-tert-butyl-8-methoxy-5,5-dimethylchromeno[4,3-c]pyridazine (PubChem CID 59774480) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 3-tert-butyl-8-methoxy-5,5-dimethylchromeno[4,3-c]pyridazine.
| Compound Name | 3-tert-butyl-8-methoxy-5,5-dimethylchromeno[4,3-c]pyridazine |
|---|---|
| PubChem CID | 59774480 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-tert-butyl-8-methoxy-5,5-dimethylchromeno[4,3-c]pyridazine |
| SMILES | COc1ccc2c(c1)OC(C)(C)c1cc(C(C)(C)C)nnc1-2 |
| InChI | InChI=1S/C18H22N2O2/c1-17(2,3)15-10-13-16(20-19-15)12-8-7-11(21-6)9-14(12)22-18(13,4)5/h7-10H,1-6H3 |
| InChIKey | FHLQIVNEPYMAKN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |