About 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole
1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole (PubChem CID 122678316) has the molecular formula C15H17BrN2O2
and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole |
| PubChem CID | 122678316 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole |
| SMILES | COc1ccc2c(c1)OC(C)(C)c1cnn(CCBr)c1-2 |
| InChI | InChI=1S/C15H17BrN2O2/c1-15(2)12-9-17-18(7-6-16)14(12)11-5-4-10(19-3)8-13(11)20-15/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | JOTSHAINQGFQEC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole?
The IUPAC name of 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole (CID 122678316) is 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole.
What is the SMILES notation for 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole?
The canonical SMILES for 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole is COc1ccc2c(c1)OC(C)(C)c1cnn(CCBr)c1-2.
What is the InChIKey of 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole?
The InChIKey is JOTSHAINQGFQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrN2O2/c1-15(2)12-9-17-18(7-6-16)14(12)11-5-4-10(19-3)8-13(11)20-15/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole?
1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole has a molecular weight of 337.22 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromoethyl)-7-methoxy-4,4-dimethylchromeno[3,4-d]pyrazole is sourced from PubChem (CID 122678316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).