C18H25Cl4N3O — CID 90675209
N,N-bis(2-chloroethyl)-2-(7-methoxy-4,5-dihydrobenzo[g]indazol-1-yl)ethanamine;dihydrochloride (PubChem CID 90675209) has the molecular formula C18H25Cl4N3O and a molecular weight of 441.23 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-(7-methoxy-4,5-dihydrobenzo[g]indazol-1-yl)ethanamine;dihydrochloride.
| Compound Name | N,N-bis(2-chloroethyl)-2-(7-methoxy-4,5-dihydrobenzo[g]indazol-1-yl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 90675209 |
| Molecular Formula | C18H25Cl4N3O |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-(7-methoxy-4,5-dihydrobenzo[g]indazol-1-yl)ethanamine;dihydrochloride |
| SMILES | COc1ccc2c(c1)CCc1cnn(CCN(CCCl)CCCl)c1-2.Cl.Cl |
| InChI | InChI=1S/C18H23Cl2N3O.2ClH/c1-24-16-4-5-17-14(12-16)2-3-15-13-21-23(18(15)17)11-10-22(8-6-19)9-7-20;;/h4-5,12-13H,2-3,6-11H2,1H3;2*1H |
| InChIKey | UCXUASQLSNWBRB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|