About 2-methyl-3H-xanthene
2-methyl-3H-xanthene (PubChem CID 91540179) has the molecular formula C14H12O
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-methyl-3H-xanthene.
Molecular Properties
| Compound Name | 2-methyl-3H-xanthene |
| PubChem CID | 91540179 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-methyl-3H-xanthene |
| SMILES | CC1=CC2=Cc3ccccc3OC2=CC1 |
| InChI | InChI=1S/C14H12O/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)15-14/h2-5,7-9H,6H2,1H3 |
| InChIKey | OSRNQFNAEBIYME-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-3H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3H-xanthene?
The IUPAC name of 2-methyl-3H-xanthene (CID 91540179) is 2-methyl-3H-xanthene.
What is the SMILES notation for 2-methyl-3H-xanthene?
The canonical SMILES for 2-methyl-3H-xanthene is CC1=CC2=Cc3ccccc3OC2=CC1.
What is the InChIKey of 2-methyl-3H-xanthene?
The InChIKey is OSRNQFNAEBIYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)15-14/h2-5,7-9H,6H2,1H3.
What are the key properties of 2-methyl-3H-xanthene?
2-methyl-3H-xanthene has a molecular weight of 196.25 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3H-xanthene is sourced from PubChem (CID 91540179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).