About isochromeno[4,3-b]chromene
isochromeno[4,3-b]chromene (PubChem CID 91373309) has the molecular formula C16H10O2
and a molecular weight of 234.25 g/mol. Its IUPAC name is isochromeno[4,3-b]chromene.
Molecular Properties
| Compound Name | isochromeno[4,3-b]chromene |
| PubChem CID | 91373309 |
| Molecular Formula | C16H10O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | isochromeno[4,3-b]chromene |
| SMILES | C1=C2OC=c3ccccc3=C2Oc2ccccc21 |
| InChI | InChI=1S/C16H10O2/c1-3-7-13-12(6-1)10-17-15-9-11-5-2-4-8-14(11)18-16(13)15/h1-10H |
| InChIKey | GBYITTLPJPWPKH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze isochromeno[4,3-b]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isochromeno[4,3-b]chromene?
The IUPAC name of isochromeno[4,3-b]chromene (CID 91373309) is isochromeno[4,3-b]chromene.
What is the SMILES notation for isochromeno[4,3-b]chromene?
The canonical SMILES for isochromeno[4,3-b]chromene is C1=C2OC=c3ccccc3=C2Oc2ccccc21.
What is the InChIKey of isochromeno[4,3-b]chromene?
The InChIKey is GBYITTLPJPWPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O2/c1-3-7-13-12(6-1)10-17-15-9-11-5-2-4-8-14(11)18-16(13)15/h1-10H.
What are the key properties of isochromeno[4,3-b]chromene?
isochromeno[4,3-b]chromene has a molecular weight of 234.25 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isochromeno[4,3-b]chromene is sourced from PubChem (CID 91373309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).