About 3-nitro-1,2-benzoxathiine
3-nitro-1,2-benzoxathiine (PubChem CID 70395522) has the molecular formula C8H5NO3S
and a molecular weight of 195.20 g/mol. Its IUPAC name is 3-nitro-1,2-benzoxathiine.
Molecular Properties
| Compound Name | 3-nitro-1,2-benzoxathiine |
| PubChem CID | 70395522 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 3-nitro-1,2-benzoxathiine |
| SMILES | O=[N+]([O-])C1=Cc2ccccc2OS1 |
| InChI | InChI=1S/C8H5NO3S/c10-9(11)8-5-6-3-1-2-4-7(6)12-13-8/h1-5H |
| InChIKey | GBIUBFUEDZWUIS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-1,2-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-1,2-benzoxathiine?
The IUPAC name of 3-nitro-1,2-benzoxathiine (CID 70395522) is 3-nitro-1,2-benzoxathiine.
What is the SMILES notation for 3-nitro-1,2-benzoxathiine?
The canonical SMILES for 3-nitro-1,2-benzoxathiine is O=[N+]([O-])C1=Cc2ccccc2OS1.
What is the InChIKey of 3-nitro-1,2-benzoxathiine?
The InChIKey is GBIUBFUEDZWUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3S/c10-9(11)8-5-6-3-1-2-4-7(6)12-13-8/h1-5H.
What are the key properties of 3-nitro-1,2-benzoxathiine?
3-nitro-1,2-benzoxathiine has a molecular weight of 195.20 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-1,2-benzoxathiine is sourced from PubChem (CID 70395522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).