C7H5NOS — CID 22055088
1,2,3-benzoxathiazine (PubChem CID 22055088) has the molecular formula C7H5NOS and a molecular weight of 151.19 g/mol. Its IUPAC name is 1,2,3-benzoxathiazine.
| Compound Name | 1,2,3-benzoxathiazine |
|---|---|
| PubChem CID | 22055088 |
| Molecular Formula | C7H5NOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | 1,2,3-benzoxathiazine |
| SMILES | C1=NSOc2ccccc21 |
| InChI | InChI=1S/C7H5NOS/c1-2-4-7-6(3-1)5-8-10-9-7/h1-5H |
| InChIKey | IUNUDTQWFOQODF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|