C14H11NO — CID 141035286
2-phenyl-2H-1,3-benzoxazine (PubChem CID 141035286) has the molecular formula C14H11NO and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-phenyl-2H-1,3-benzoxazine.
| Compound Name | 2-phenyl-2H-1,3-benzoxazine |
|---|---|
| PubChem CID | 141035286 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 2-phenyl-2H-1,3-benzoxazine |
| SMILES | C1=NC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C14H11NO/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-10,14H |
| InChIKey | FWGRBSKFTSRZHA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |