About 2H-chromene-2-thiol
2H-chromene-2-thiol (PubChem CID 154323304) has the molecular formula C9H8OS
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2H-chromene-2-thiol.
Molecular Properties
| Compound Name | 2H-chromene-2-thiol |
| PubChem CID | 154323304 |
| Molecular Formula | C9H8OS |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 2H-chromene-2-thiol |
| SMILES | SC1C=Cc2ccccc2O1 |
| InChI | InChI=1S/C9H8OS/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6,9,11H |
| InChIKey | NSLRHTOEMSEZBO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2H-chromene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene-2-thiol?
The IUPAC name of 2H-chromene-2-thiol (CID 154323304) is 2H-chromene-2-thiol.
What is the SMILES notation for 2H-chromene-2-thiol?
The canonical SMILES for 2H-chromene-2-thiol is SC1C=Cc2ccccc2O1.
What is the InChIKey of 2H-chromene-2-thiol?
The InChIKey is NSLRHTOEMSEZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8OS/c11-9-6-5-7-3-1-2-4-8(7)10-9/h1-6,9,11H.
What are the key properties of 2H-chromene-2-thiol?
2H-chromene-2-thiol has a molecular weight of 164.23 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene-2-thiol is sourced from PubChem (CID 154323304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).