C18H11F3O — CID 154717761
2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2H-chromene (PubChem CID 154717761) has the molecular formula C18H11F3O and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2H-chromene.
| Compound Name | 2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2H-chromene |
|---|---|
| PubChem CID | 154717761 |
| Molecular Formula | C18H11F3O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2H-chromene |
| SMILES | FC(F)(F)c1ccc(C#CC2C=Cc3ccccc3O2)cc1 |
| InChI | InChI=1S/C18H11F3O/c19-18(20,21)15-9-5-13(6-10-15)7-11-16-12-8-14-3-1-2-4-17(14)22-16/h1-6,8-10,12,16H |
| InChIKey | ORTNFFNIJZFTNJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|