C11H7F5O2 — CID 18755186
2-(1,1,2,2,2-pentafluoroethyl)-2H-chromen-3-ol (PubChem CID 18755186) has the molecular formula C11H7F5O2 and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-2H-chromen-3-ol.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-2H-chromen-3-ol |
|---|---|
| PubChem CID | 18755186 |
| Molecular Formula | C11H7F5O2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-2H-chromen-3-ol |
| SMILES | OC1=Cc2ccccc2OC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F5O2/c12-10(13,11(14,15)16)9-7(17)5-6-3-1-2-4-8(6)18-9/h1-5,9,17H |
| InChIKey | NOTQEAQJBHVZHU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|