About 1-fluoro-1H-inden-2-ol
1-fluoro-1H-inden-2-ol (PubChem CID 174381706) has the molecular formula C9H7FO
and a molecular weight of 150.15 g/mol. Its IUPAC name is 1-fluoro-1H-inden-2-ol.
Molecular Properties
| Compound Name | 1-fluoro-1H-inden-2-ol |
| PubChem CID | 174381706 |
| Molecular Formula | C9H7FO |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 1-fluoro-1H-inden-2-ol |
| SMILES | OC1=Cc2ccccc2C1F |
| InChI | InChI=1S/C9H7FO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-5,9,11H |
| InChIKey | WZHVGJFJVDMULY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-1H-inden-2-ol?
The IUPAC name of 1-fluoro-1H-inden-2-ol (CID 174381706) is 1-fluoro-1H-inden-2-ol.
What is the SMILES notation for 1-fluoro-1H-inden-2-ol?
The canonical SMILES for 1-fluoro-1H-inden-2-ol is OC1=Cc2ccccc2C1F.
What is the InChIKey of 1-fluoro-1H-inden-2-ol?
The InChIKey is WZHVGJFJVDMULY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-5,9,11H.
What are the key properties of 1-fluoro-1H-inden-2-ol?
1-fluoro-1H-inden-2-ol has a molecular weight of 150.15 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-1H-inden-2-ol is sourced from PubChem (CID 174381706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).