C12H7F5O2 — CID 154585851
1-(2H-chromen-2-yl)-1,1,3,3,3-pentafluoropropan-2-one (PubChem CID 154585851) has the molecular formula C12H7F5O2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 1-(2H-chromen-2-yl)-1,1,3,3,3-pentafluoropropan-2-one.
| Compound Name | 1-(2H-chromen-2-yl)-1,1,3,3,3-pentafluoropropan-2-one |
|---|---|
| PubChem CID | 154585851 |
| Molecular Formula | C12H7F5O2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-(2H-chromen-2-yl)-1,1,3,3,3-pentafluoropropan-2-one |
| SMILES | O=C(C(F)(F)F)C(F)(F)C1C=Cc2ccccc2O1 |
| InChI | InChI=1S/C12H7F5O2/c13-11(14,10(18)12(15,16)17)9-6-5-7-3-1-2-4-8(7)19-9/h1-6,9H |
| InChIKey | UXBQPUSIMJJRTO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |