C11H7F3O3 — CID 174270923
6-(trifluoromethyl)-2H-chromene-2-carboxylic acid (PubChem CID 174270923) has the molecular formula C11H7F3O3 and a molecular weight of 244.17 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2H-chromene-2-carboxylic acid.
| Compound Name | 6-(trifluoromethyl)-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 174270923 |
| Molecular Formula | C11H7F3O3 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-(trifluoromethyl)-2H-chromene-2-carboxylic acid |
| SMILES | O=C(O)C1C=Cc2cc(C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C11H7F3O3/c12-11(13,14)7-2-4-8-6(5-7)1-3-9(17-8)10(15)16/h1-5,9H,(H,15,16) |
| InChIKey | HDLGPXUZLUDLGO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |