About benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran
benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran (PubChem CID 172603158) has the molecular formula C18H19F3O3
and a molecular weight of 340.34 g/mol. Its IUPAC name is benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran |
| PubChem CID | 172603158 |
| Molecular Formula | C18H19F3O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran |
| SMILES | CC.FC(F)(F)c1ccc2c(c1)CCO2.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H7F3O.C7H6O2.C2H6/c10-9(11,12)7-1-2-8-6(5-7)3-4-13-8;8-7(9)6-4-2-1-3-5-6;1-2/h1-2,5H,3-4H2;1-5H,(H,8,9);1-2H3 |
| InChIKey | DOOZANFYWYIMQM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran?
The IUPAC name of benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran (CID 172603158) is benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran is CC.FC(F)(F)c1ccc2c(c1)CCO2.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran?
The InChIKey is DOOZANFYWYIMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O.C7H6O2.C2H6/c10-9(11,12)7-1-2-8-6(5-7)3-4-13-8;8-7(9)6-4-2-1-3-5-6;1-2/h1-2,5H,3-4H2;1-5H,(H,8,9);1-2H3.
What are the key properties of benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran?
benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran has a molecular weight of 340.34 g/mol, XLogP of 5.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;ethane;5-(trifluoromethyl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 172603158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).