C16H17NO — CID 104542207
1-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylethanamine (PubChem CID 104542207) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylethanamine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylethanamine |
|---|---|
| PubChem CID | 104542207 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-1-phenylethanamine |
| SMILES | CC(N)(c1ccccc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H17NO/c1-16(17,13-5-3-2-4-6-13)14-7-8-15-12(11-14)9-10-18-15/h2-8,11H,9-10,17H2,1H3 |
| InChIKey | YANYFMQBAAAVKL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |