C21H15F3O3 — CID 102340084
(6S,7R)-7-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,6,7-tetrahydrobenzo[g][1,4]benzodioxin-6-ol (PubChem CID 102340084) has the molecular formula C21H15F3O3 and a molecular weight of 372.34 g/mol. Its IUPAC name is (6S,7R)-7-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,6,7-tetrahydrobenzo[g][1,4]benzodioxin-6-ol.
| Compound Name | (6S,7R)-7-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,6,7-tetrahydrobenzo[g][1,4]benzodioxin-6-ol |
|---|---|
| PubChem CID | 102340084 |
| Molecular Formula | C21H15F3O3 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (6S,7R)-7-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,6,7-tetrahydrobenzo[g][1,4]benzodioxin-6-ol |
| SMILES | O[C@@H]1c2cc3c(cc2C=C[C@@H]1C#Cc1ccc(C(F)(F)F)cc1)OCCO3 |
| InChI | InChI=1S/C21H15F3O3/c22-21(23,24)16-7-2-13(3-8-16)1-4-14-5-6-15-11-18-19(27-10-9-26-18)12-17(15)20(14)25/h2-3,5-8,11-12,14,20,25H,9-10H2/t14-,20-/m0/s1 |
| InChIKey | QBGAYMCVUODSGJ-XOBRGWDASA-N |
| XLogP | 4.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|