C21H19F3O — CID 102340085
(1R,2S)-6,7-dimethyl-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 102340085) has the molecular formula C21H19F3O and a molecular weight of 344.38 g/mol. Its IUPAC name is (1R,2S)-6,7-dimethyl-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2S)-6,7-dimethyl-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102340085 |
| Molecular Formula | C21H19F3O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (1R,2S)-6,7-dimethyl-2-[2-[4-(trifluoromethyl)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | Cc1cc2c(cc1C)[C@H](O)[C@H](C#Cc1ccc(C(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C21H19F3O/c1-13-11-17-8-7-16(20(25)19(17)12-14(13)2)6-3-15-4-9-18(10-5-15)21(22,23)24/h4-5,9-12,16,20,25H,7-8H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | ABYUHGOUPSXYOR-OXQOHEQNSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|