C21H19F3N2O — CID 143190840
(2R)-N-[2-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 143190840) has the molecular formula C21H19F3N2O and a molecular weight of 372.39 g/mol. Its IUPAC name is (2R)-N-[2-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143190840 |
| Molecular Formula | C21H19F3N2O |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (2R)-N-[2-methyl-4-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C#Cc2ccc(C(F)(F)F)cc2)ccc1NC(=O)[C@H]1CCCN1 |
| InChI | InChI=1S/C21H19F3N2O/c1-14-13-16(5-4-15-6-9-17(10-7-15)21(22,23)24)8-11-18(14)26-20(27)19-3-2-12-25-19/h6-11,13,19,25H,2-3,12H2,1H3,(H,26,27)/t19-/m1/s1 |
| InChIKey | ZODXQCVNJWAGPE-LJQANCHMSA-N |
| XLogP | 4.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|