C19H16F3N3O — CID 143190836
(2R)-N-[6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 143190836) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is (2R)-N-[6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143190836 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2R)-N-[6-[2-[4-(trifluoromethyl)phenyl]ethynyl]-3-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C#Cc2ccc(C(F)(F)F)cc2)nc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C19H16F3N3O/c20-19(21,22)14-6-3-13(4-7-14)5-8-15-9-10-16(12-24-15)25-18(26)17-2-1-11-23-17/h3-4,6-7,9-10,12,17,23H,1-2,11H2,(H,25,26)/t17-/m1/s1 |
| InChIKey | OPXDODGQQJMXTK-QGZVFWFLSA-N |
| XLogP | 3.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|