C24H27F3NO2+ — CID 158070652
7-methyl-9-propyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3,8,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinolin-7-ium (PubChem CID 158070652) has the molecular formula C24H27F3NO2+ and a molecular weight of 418.48 g/mol. Its IUPAC name is 7-methyl-9-propyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3,8,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinolin-7-ium.
| Compound Name | 7-methyl-9-propyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3,8,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinolin-7-ium |
|---|---|
| PubChem CID | 158070652 |
| Molecular Formula | C24H27F3NO2+ |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 7-methyl-9-propyl-6-[2-[4-(trifluoromethyl)phenyl]ethyl]-2,3,8,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinolin-7-ium |
| SMILES | CCCC1C[N+](C)=C(CCc2ccc(C(F)(F)F)cc2)c2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C24H27F3NO2/c1-3-4-17-15-28(2)21(10-7-16-5-8-18(9-6-16)24(25,26)27)20-14-23-22(13-19(17)20)29-11-12-30-23/h5-6,8-9,13-14,17H,3-4,7,10-12,15H2,1-2H3/q+1 |
| InChIKey | FLTYLLOJXUXAGX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|