C17H11N3O4 — CID 21239784
2-(4-nitrophenyl)-2,3-dihydrochromeno[2,3-d]pyrimidin-4-one (PubChem CID 21239784) has the molecular formula C17H11N3O4 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-2,3-dihydrochromeno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-nitrophenyl)-2,3-dihydrochromeno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 21239784 |
| Molecular Formula | C17H11N3O4 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-(4-nitrophenyl)-2,3-dihydrochromeno[2,3-d]pyrimidin-4-one |
| SMILES | O=C1NC(c2ccc([N+](=O)[O-])cc2)N=C2Oc3ccccc3C=C12 |
| InChI | InChI=1S/C17H11N3O4/c21-16-13-9-11-3-1-2-4-14(11)24-17(13)19-15(18-16)10-5-7-12(8-6-10)20(22)23/h1-9,15H,(H,18,21) |
| InChIKey | BUXYXXQNGUFJJJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|