C20H15N3O2 — CID 132933614
2-(4-nitrophenyl)-4-phenyl-1,2-dihydroquinazoline (PubChem CID 132933614) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4-phenyl-1,2-dihydroquinazoline.
| Compound Name | 2-(4-nitrophenyl)-4-phenyl-1,2-dihydroquinazoline |
|---|---|
| PubChem CID | 132933614 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(4-nitrophenyl)-4-phenyl-1,2-dihydroquinazoline |
| SMILES | O=[N+]([O-])c1ccc(C2N=C(c3ccccc3)c3ccccc3N2)cc1 |
| InChI | InChI=1S/C20H15N3O2/c24-23(25)16-12-10-15(11-13-16)20-21-18-9-5-4-8-17(18)19(22-20)14-6-2-1-3-7-14/h1-13,20-21H |
| InChIKey | UELFBDYHMPOPOL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|