C31H25N3O2 — CID 101023359
5-(4-nitrophenyl)-2-phenyl-3-[(3-phenyl-1H-inden-1-yl)methyl]-1,5-dihydropyrazole (PubChem CID 101023359) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-2-phenyl-3-[(3-phenyl-1H-inden-1-yl)methyl]-1,5-dihydropyrazole.
| Compound Name | 5-(4-nitrophenyl)-2-phenyl-3-[(3-phenyl-1H-inden-1-yl)methyl]-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 101023359 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 5-(4-nitrophenyl)-2-phenyl-3-[(3-phenyl-1H-inden-1-yl)methyl]-1,5-dihydropyrazole |
| SMILES | O=[N+]([O-])c1ccc(C2C=C(CC3C=C(c4ccccc4)c4ccccc43)N(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C31H25N3O2/c35-34(36)26-17-15-23(16-18-26)31-21-27(33(32-31)25-11-5-2-6-12-25)19-24-20-30(22-9-3-1-4-10-22)29-14-8-7-13-28(24)29/h1-18,20-21,24,31-32H,19H2 |
| InChIKey | NFMAEJSMMRMQHE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|