C14H10N6O2 — CID 4522525
5-(4-nitrophenyl)-5,6-dihydrotetrazolo[1,5-c]quinazoline (PubChem CID 4522525) has the molecular formula C14H10N6O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-5,6-dihydrotetrazolo[1,5-c]quinazoline.
| Compound Name | 5-(4-nitrophenyl)-5,6-dihydrotetrazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 4522525 |
| Molecular Formula | C14H10N6O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-(4-nitrophenyl)-5,6-dihydrotetrazolo[1,5-c]quinazoline |
| SMILES | O=[N+]([O-])c1ccc(C2Nc3ccccc3-c3nnnn32)cc1 |
| InChI | InChI=1S/C14H10N6O2/c21-20(22)10-7-5-9(6-8-10)13-15-12-4-2-1-3-11(12)14-16-17-18-19(13)14/h1-8,13,15H |
| InChIKey | WQTUGHGVIUOVPX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|