C16H14N2O3 — CID 15896957
(4R,5S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 15896957) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (4R,5S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15896957 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (4R,5S)-4-methyl-2-(4-nitrophenyl)-5-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@H]1N=C(c2ccc([N+](=O)[O-])cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3/c1-11-15(12-5-3-2-4-6-12)21-16(17-11)13-7-9-14(10-8-13)18(19)20/h2-11,15H,1H3/t11-,15-/m1/s1 |
| InChIKey | YTAYIPRKKPJSPV-IAQYHMDHSA-N |
| XLogP | 3.50 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|