C22H16N2O4 — CID 139221421
[(4S,5R)-5-(3-nitrophenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanone (PubChem CID 139221421) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is [(4S,5R)-5-(3-nitrophenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanone.
| Compound Name | [(4S,5R)-5-(3-nitrophenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139221421 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(4S,5R)-5-(3-nitrophenyl)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1N=C(c2ccccc2)O[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N2O4/c25-20(15-8-3-1-4-9-15)19-21(17-12-7-13-18(14-17)24(26)27)28-22(23-19)16-10-5-2-6-11-16/h1-14,19,21H/t19-,21-/m1/s1 |
| InChIKey | CZDDOTHNCYUVLI-TZIWHRDSSA-N |
| XLogP | 4.36 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|