About 3-(4-nitrophenyl)-1,4-benzodioxine
3-(4-nitrophenyl)-1,4-benzodioxine (PubChem CID 2320216) has the molecular formula C14H9NO4
and a molecular weight of 255.23 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1,4-benzodioxine.
Molecular Properties
| Compound Name | 3-(4-nitrophenyl)-1,4-benzodioxine |
| PubChem CID | 2320216 |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 3-(4-nitrophenyl)-1,4-benzodioxine |
| SMILES | O=[N+]([O-])c1ccc(C2=COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C14H9NO4/c16-15(17)11-7-5-10(6-8-11)14-9-18-12-3-1-2-4-13(12)19-14/h1-9H |
| InChIKey | OLFDQUNVCWPSBA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-nitrophenyl)-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-nitrophenyl)-1,4-benzodioxine?
The IUPAC name of 3-(4-nitrophenyl)-1,4-benzodioxine (CID 2320216) is 3-(4-nitrophenyl)-1,4-benzodioxine.
What is the SMILES notation for 3-(4-nitrophenyl)-1,4-benzodioxine?
The canonical SMILES for 3-(4-nitrophenyl)-1,4-benzodioxine is O=[N+]([O-])c1ccc(C2=COc3ccccc3O2)cc1.
What is the InChIKey of 3-(4-nitrophenyl)-1,4-benzodioxine?
The InChIKey is OLFDQUNVCWPSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO4/c16-15(17)11-7-5-10(6-8-11)14-9-18-12-3-1-2-4-13(12)19-14/h1-9H.
What are the key properties of 3-(4-nitrophenyl)-1,4-benzodioxine?
3-(4-nitrophenyl)-1,4-benzodioxine has a molecular weight of 255.23 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-nitrophenyl)-1,4-benzodioxine is sourced from PubChem (CID 2320216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).