About 3H-thieno[3,4-c][1]benzoxepin-1-one
3H-thieno[3,4-c][1]benzoxepin-1-one (PubChem CID 70499394) has the molecular formula C12H8O2S
and a molecular weight of 216.26 g/mol. Its IUPAC name is 3H-thieno[3,4-c][1]benzoxepin-1-one.
Molecular Properties
| Compound Name | 3H-thieno[3,4-c][1]benzoxepin-1-one |
| PubChem CID | 70499394 |
| Molecular Formula | C12H8O2S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 3H-thieno[3,4-c][1]benzoxepin-1-one |
| SMILES | O=C1SCC2=COc3ccccc3C=C12 |
| InChI | InChI=1S/C12H8O2S/c13-12-10-5-8-3-1-2-4-11(8)14-6-9(10)7-15-12/h1-6H,7H2 |
| InChIKey | KKTOCYWSEQLYSJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3H-thieno[3,4-c][1]benzoxepin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-thieno[3,4-c][1]benzoxepin-1-one?
The IUPAC name of 3H-thieno[3,4-c][1]benzoxepin-1-one (CID 70499394) is 3H-thieno[3,4-c][1]benzoxepin-1-one.
What is the SMILES notation for 3H-thieno[3,4-c][1]benzoxepin-1-one?
The canonical SMILES for 3H-thieno[3,4-c][1]benzoxepin-1-one is O=C1SCC2=COc3ccccc3C=C12.
What is the InChIKey of 3H-thieno[3,4-c][1]benzoxepin-1-one?
The InChIKey is KKTOCYWSEQLYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2S/c13-12-10-5-8-3-1-2-4-11(8)14-6-9(10)7-15-12/h1-6H,7H2.
What are the key properties of 3H-thieno[3,4-c][1]benzoxepin-1-one?
3H-thieno[3,4-c][1]benzoxepin-1-one has a molecular weight of 216.26 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-thieno[3,4-c][1]benzoxepin-1-one is sourced from PubChem (CID 70499394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).