C10H7N3O2 — CID 90219930
1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 90219930) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is 1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | 1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 90219930 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | O=C1CN2C(=COc3ccccc32)N=N1 |
| InChI | InChI=1S/C10H7N3O2/c14-10-5-13-7-3-1-2-4-8(7)15-6-9(13)11-12-10/h1-4,6H,5H2 |
| InChIKey | JNDNRIVHCZNDIV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |