C9H6Cl2O2 — CID 86025414
3,4-dichloro-2H-1,5-benzodioxepine (PubChem CID 86025414) has the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. Its IUPAC name is 3,4-dichloro-2H-1,5-benzodioxepine.
| Compound Name | 3,4-dichloro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 86025414 |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 3,4-dichloro-2H-1,5-benzodioxepine |
| SMILES | ClC1=C(Cl)Oc2ccccc2OC1 |
| InChI | InChI=1S/C9H6Cl2O2/c10-6-5-12-7-3-1-2-4-8(7)13-9(6)11/h1-4H,5H2 |
| InChIKey | OIUZYZNVNPXFMD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |