C13H14N2O2 — CID 165410431
5H-[1,5]benzodioxepino[4,3-b]pyridine;methanamine (PubChem CID 165410431) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 5H-[1,5]benzodioxepino[4,3-b]pyridine;methanamine.
| Compound Name | 5H-[1,5]benzodioxepino[4,3-b]pyridine;methanamine |
|---|---|
| PubChem CID | 165410431 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 5H-[1,5]benzodioxepino[4,3-b]pyridine;methanamine |
| SMILES | CN.c1cnc2c(c1)COc1ccccc1O2 |
| InChI | InChI=1S/C12H9NO2.CH5N/c1-2-6-11-10(5-1)14-8-9-4-3-7-13-12(9)15-11;1-2/h1-7H,8H2;2H2,1H3 |
| InChIKey | ITRHTRLQYBUCFZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |