About 10H-chromeno[2,3-b]pyrazine
10H-chromeno[2,3-b]pyrazine (PubChem CID 140937622) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 10H-chromeno[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 10H-chromeno[2,3-b]pyrazine |
| PubChem CID | 140937622 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 10H-chromeno[2,3-b]pyrazine |
| SMILES | c1ccc2c(c1)Cc1nccnc1O2 |
| InChI | InChI=1S/C11H8N2O/c1-2-4-10-8(3-1)7-9-11(14-10)13-6-5-12-9/h1-6H,7H2 |
| InChIKey | IXSQETRTRALKLR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10H-chromeno[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-chromeno[2,3-b]pyrazine?
The IUPAC name of 10H-chromeno[2,3-b]pyrazine (CID 140937622) is 10H-chromeno[2,3-b]pyrazine.
What is the SMILES notation for 10H-chromeno[2,3-b]pyrazine?
The canonical SMILES for 10H-chromeno[2,3-b]pyrazine is c1ccc2c(c1)Cc1nccnc1O2.
What is the InChIKey of 10H-chromeno[2,3-b]pyrazine?
The InChIKey is IXSQETRTRALKLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-2-4-10-8(3-1)7-9-11(14-10)13-6-5-12-9/h1-6H,7H2.
What are the key properties of 10H-chromeno[2,3-b]pyrazine?
10H-chromeno[2,3-b]pyrazine has a molecular weight of 184.20 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-chromeno[2,3-b]pyrazine is sourced from PubChem (CID 140937622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).