C16H12O — CID 86188661
11-oxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12,16-heptaene (PubChem CID 86188661) has the molecular formula C16H12O and a molecular weight of 220.27 g/mol. Its IUPAC name is 11-oxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12,16-heptaene.
| Compound Name | 11-oxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12,16-heptaene |
|---|---|
| PubChem CID | 86188661 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 11-oxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12,16-heptaene |
| SMILES | C1=C2CCC=C2Oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C16H12O/c1-2-6-13-11(4-1)8-9-16-14(13)10-12-5-3-7-15(12)17-16/h1-2,4,6-10H,3,5H2 |
| InChIKey | FMFMGLJJWWFIQS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |