C20H17N — CID 162372540
2-phenyl-4,5-dihydro-3H-benzo[g][1]benzazepine (PubChem CID 162372540) has the molecular formula C20H17N and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-phenyl-4,5-dihydro-3H-benzo[g][1]benzazepine.
| Compound Name | 2-phenyl-4,5-dihydro-3H-benzo[g][1]benzazepine |
|---|---|
| PubChem CID | 162372540 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-phenyl-4,5-dihydro-3H-benzo[g][1]benzazepine |
| SMILES | C1=C(c2ccccc2)CCNc2ccc3ccccc3c21 |
| InChI | InChI=1S/C20H17N/c1-2-6-15(7-3-1)17-12-13-21-20-11-10-16-8-4-5-9-18(16)19(20)14-17/h1-11,14,21H,12-13H2 |
| InChIKey | BKUAQJDRCKGJCL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|