C15H17NO — CID 113422620
2,2-dimethyl-4,5-dihydro-3H-benzo[i][1,5]benzoxazepine (PubChem CID 113422620) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2,2-dimethyl-4,5-dihydro-3H-benzo[i][1,5]benzoxazepine.
| Compound Name | 2,2-dimethyl-4,5-dihydro-3H-benzo[i][1,5]benzoxazepine |
|---|---|
| PubChem CID | 113422620 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2,2-dimethyl-4,5-dihydro-3H-benzo[i][1,5]benzoxazepine |
| SMILES | CC1(C)CCNc2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C15H17NO/c1-15(2)9-10-16-13-8-7-11-5-3-4-6-12(11)14(13)17-15/h3-8,16H,9-10H2,1-2H3 |
| InChIKey | ARUKNEFDWFAQJG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |