C16H29N — CID 142006260
4,4-dimethyl-1,2,3,5-tetrahydro-1-benzazepine;ethane (PubChem CID 142006260) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 4,4-dimethyl-1,2,3,5-tetrahydro-1-benzazepine;ethane.
| Compound Name | 4,4-dimethyl-1,2,3,5-tetrahydro-1-benzazepine;ethane |
|---|---|
| PubChem CID | 142006260 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 4,4-dimethyl-1,2,3,5-tetrahydro-1-benzazepine;ethane |
| SMILES | CC.CC.CC1(C)CCNc2ccccc2C1 |
| InChI | InChI=1S/C12H17N.2C2H6/c1-12(2)7-8-13-11-6-4-3-5-10(11)9-12;2*1-2/h3-6,13H,7-9H2,1-2H3;2*1-2H3 |
| InChIKey | VMLHTTRKXAVLQT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |