About 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene
6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene (PubChem CID 23270637) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene.
Analyze 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene?
The IUPAC name of 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene (CID 23270637) is 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene.
What is the SMILES notation for 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene?
The canonical SMILES for 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene is CC1(C)Cc2ccccc2CC(C)(C)C1.
What is the InChIKey of 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene?
The InChIKey is NHUNFQUMJAISHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-14(2)9-12-7-5-6-8-13(12)10-15(3,4)11-14/h5-8H,9-11H2,1-4H3.
What are the key properties of 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene?
6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene has a molecular weight of 202.34 g/mol, XLogP of 4.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6,8,8-tetramethyl-7,9-dihydro-5H-benzo[7]annulene is sourced from PubChem (CID 23270637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).