C14H17N — CID 91133657
spiro[1,2,3,5-tetrahydro-1-benzazepine-4,3'-cyclopentene] (PubChem CID 91133657) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is spiro[1,2,3,5-tetrahydro-1-benzazepine-4,3'-cyclopentene].
| Compound Name | spiro[1,2,3,5-tetrahydro-1-benzazepine-4,3'-cyclopentene] |
|---|---|
| PubChem CID | 91133657 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | spiro[1,2,3,5-tetrahydro-1-benzazepine-4,3'-cyclopentene] |
| SMILES | C1=CC2(CC1)CCNc1ccccc1C2 |
| InChI | InChI=1S/C14H17N/c1-2-6-13-12(5-1)11-14(9-10-15-13)7-3-4-8-14/h1-3,5-7,15H,4,8-11H2 |
| InChIKey | SBUMWBKKAXZYHC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|