C16H18N2 — CID 102232178
2,9-diazatricyclo[12.4.0.03,8]octadeca-1(18),3,5,7,14,16-hexaene (PubChem CID 102232178) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,9-diazatricyclo[12.4.0.03,8]octadeca-1(18),3,5,7,14,16-hexaene.
| Compound Name | 2,9-diazatricyclo[12.4.0.03,8]octadeca-1(18),3,5,7,14,16-hexaene |
|---|---|
| PubChem CID | 102232178 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2,9-diazatricyclo[12.4.0.03,8]octadeca-1(18),3,5,7,14,16-hexaene |
| SMILES | c1ccc2c(c1)CCCCNc1ccccc1N2 |
| InChI | InChI=1S/C16H18N2/c1-2-9-14-13(7-1)8-5-6-12-17-15-10-3-4-11-16(15)18-14/h1-4,7,9-11,17-18H,5-6,8,12H2 |
| InChIKey | VVDKQFQJLDJEMN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |