C16H16OS — CID 176766084
spiro[benzo[g][1,3]benzoxathiole-2,1'-cyclohexane] (PubChem CID 176766084) has the molecular formula C16H16OS and a molecular weight of 256.37 g/mol. Its IUPAC name is spiro[benzo[g][1,3]benzoxathiole-2,1'-cyclohexane].
| Compound Name | spiro[benzo[g][1,3]benzoxathiole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 176766084 |
| Molecular Formula | C16H16OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | spiro[benzo[g][1,3]benzoxathiole-2,1'-cyclohexane] |
| SMILES | c1ccc2c3c(ccc2c1)SC1(CCCCC1)O3 |
| InChI | InChI=1S/C16H16OS/c1-4-10-16(11-5-1)17-15-13-7-3-2-6-12(13)8-9-14(15)18-16/h2-3,6-9H,1,4-5,10-11H2 |
| InChIKey | VQOCNTHYAUSFCP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |