C12H9NO — CID 18365559
4H-benzo[h][1,4]benzoxazine (PubChem CID 18365559) has the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. Its IUPAC name is 4H-benzo[h][1,4]benzoxazine.
| Compound Name | 4H-benzo[h][1,4]benzoxazine |
|---|---|
| PubChem CID | 18365559 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 4H-benzo[h][1,4]benzoxazine |
| SMILES | C1=COc2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C12H9NO/c1-2-4-10-9(3-1)5-6-11-12(10)14-8-7-13-11/h1-8,13H |
| InChIKey | XCJGFLHSHZJXGK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |